C28H23N3O2 — CID 100762045
N-benzhydryl-3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 100762045) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-benzhydryl-3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-benzhydryl-3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 100762045 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-benzhydryl-3-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2cccc3ccccc23)no1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O2/c32-25(29-27(21-11-3-1-4-12-21)22-13-5-2-6-14-22)18-19-26-30-28(31-33-26)24-17-9-15-20-10-7-8-16-23(20)24/h1-17,27H,18-19H2,(H,29,32) |
| InChIKey | UKJZRYOJQTZPJO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |