C29H29BrO6 — CID 10076327
[(3S,4S,5S,6R)-6-acetyloxy-3-benzoyloxy-5-bromo-4-methyl-6-phenylhexyl] benzoate (PubChem CID 10076327) has the molecular formula C29H29BrO6 and a molecular weight of 553.45 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-6-acetyloxy-3-benzoyloxy-5-bromo-4-methyl-6-phenylhexyl] benzoate.
| Compound Name | [(3S,4S,5S,6R)-6-acetyloxy-3-benzoyloxy-5-bromo-4-methyl-6-phenylhexyl] benzoate |
|---|---|
| PubChem CID | 10076327 |
| Molecular Formula | C29H29BrO6 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | [(3S,4S,5S,6R)-6-acetyloxy-3-benzoyloxy-5-bromo-4-methyl-6-phenylhexyl] benzoate |
| SMILES | CC(=O)O[C@H](c1ccccc1)[C@@H](Br)[C@@H](C)[C@H](CCOC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29BrO6/c1-20(26(30)27(35-21(2)31)22-12-6-3-7-13-22)25(36-29(33)24-16-10-5-11-17-24)18-19-34-28(32)23-14-8-4-9-15-23/h3-17,20,25-27H,18-19H2,1-2H3/t20-,25-,26-,27+/m0/s1 |
| InChIKey | KHNKKMLBNQYNLD-GIIILEAUSA-N |
| XLogP | 6.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|