C14H20N2O3 — CID 100763280
oxan-4-yl N-ethyl-N-(pyridin-2-ylmethyl)carbamate (PubChem CID 100763280) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is oxan-4-yl N-ethyl-N-(pyridin-2-ylmethyl)carbamate.
| Compound Name | oxan-4-yl N-ethyl-N-(pyridin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 100763280 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | oxan-4-yl N-ethyl-N-(pyridin-2-ylmethyl)carbamate |
| SMILES | CCN(Cc1ccccn1)C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-16(11-12-5-3-4-8-15-12)14(17)19-13-6-9-18-10-7-13/h3-5,8,13H,2,6-7,9-11H2,1H3 |
| InChIKey | WKBBXYBSALZNOS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |