C18H14BrFN4 — CID 100764754
5-amino-3-[(4-bromophenyl)methyl]-1-[(2-fluorophenyl)methyl]pyrazole-4-carbonitrile (PubChem CID 100764754) has the molecular formula C18H14BrFN4 and a molecular weight of 385.24 g/mol. Its IUPAC name is 5-amino-3-[(4-bromophenyl)methyl]-1-[(2-fluorophenyl)methyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(4-bromophenyl)methyl]-1-[(2-fluorophenyl)methyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 100764754 |
| Molecular Formula | C18H14BrFN4 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 5-amino-3-[(4-bromophenyl)methyl]-1-[(2-fluorophenyl)methyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(Cc2ccc(Br)cc2)nn(Cc2ccccc2F)c1N |
| InChI | InChI=1S/C18H14BrFN4/c19-14-7-5-12(6-8-14)9-17-15(10-21)18(22)24(23-17)11-13-3-1-2-4-16(13)20/h1-8H,9,11,22H2 |
| InChIKey | DFWCJXTUVNBPGB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |