C18H14Cl2N4 — CID 100764287
5-amino-1-[(2-chlorophenyl)methyl]-3-[(4-chlorophenyl)methyl]pyrazole-4-carbonitrile (PubChem CID 100764287) has the molecular formula C18H14Cl2N4 and a molecular weight of 357.24 g/mol. Its IUPAC name is 5-amino-1-[(2-chlorophenyl)methyl]-3-[(4-chlorophenyl)methyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[(2-chlorophenyl)methyl]-3-[(4-chlorophenyl)methyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 100764287 |
| Molecular Formula | C18H14Cl2N4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 5-amino-1-[(2-chlorophenyl)methyl]-3-[(4-chlorophenyl)methyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(Cc2ccc(Cl)cc2)nn(Cc2ccccc2Cl)c1N |
| InChI | InChI=1S/C18H14Cl2N4/c19-14-7-5-12(6-8-14)9-17-15(10-21)18(22)24(23-17)11-13-3-1-2-4-16(13)20/h1-8H,9,11,22H2 |
| InChIKey | BYWZNXGLZPPUJZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |