C14H15ClN6 — CID 102796539
5-amino-3-(azetidin-3-ylamino)-1-[(2-chlorophenyl)methyl]pyrazole-4-carbonitrile (PubChem CID 102796539) has the molecular formula C14H15ClN6 and a molecular weight of 302.77 g/mol. Its IUPAC name is 5-amino-3-(azetidin-3-ylamino)-1-[(2-chlorophenyl)methyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(azetidin-3-ylamino)-1-[(2-chlorophenyl)methyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796539 |
| Molecular Formula | C14H15ClN6 |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-amino-3-(azetidin-3-ylamino)-1-[(2-chlorophenyl)methyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(NC2CNC2)nn(Cc2ccccc2Cl)c1N |
| InChI | InChI=1S/C14H15ClN6/c15-12-4-2-1-3-9(12)8-21-13(17)11(5-16)14(20-21)19-10-6-18-7-10/h1-4,10,18H,6-8,17H2,(H,19,20) |
| InChIKey | VNKSRPNZRZJNBS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |