C12H16N2O3 — CID 100767762
N-(2-phenoxyethyl)-1,2-oxazolidine-2-carboxamide (PubChem CID 100767762) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-1,2-oxazolidine-2-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-1,2-oxazolidine-2-carboxamide |
|---|---|
| PubChem CID | 100767762 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(2-phenoxyethyl)-1,2-oxazolidine-2-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)N1CCCO1 |
| InChI | InChI=1S/C12H16N2O3/c15-12(14-8-4-9-17-14)13-7-10-16-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,13,15) |
| InChIKey | INZCGMKTXDDESR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|