C21H21N5O4 — CID 100767918
N'-[1-(2-amino-2-oxoethyl)pyrazol-3-yl]-N-(2-methyl-4-phenylmethoxyphenyl)oxamide (PubChem CID 100767918) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N'-[1-(2-amino-2-oxoethyl)pyrazol-3-yl]-N-(2-methyl-4-phenylmethoxyphenyl)oxamide.
| Compound Name | N'-[1-(2-amino-2-oxoethyl)pyrazol-3-yl]-N-(2-methyl-4-phenylmethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 100767918 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N'-[1-(2-amino-2-oxoethyl)pyrazol-3-yl]-N-(2-methyl-4-phenylmethoxyphenyl)oxamide |
| SMILES | Cc1cc(OCc2ccccc2)ccc1NC(=O)C(=O)Nc1ccn(CC(N)=O)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-14-11-16(30-13-15-5-3-2-4-6-15)7-8-17(14)23-20(28)21(29)24-19-9-10-26(25-19)12-18(22)27/h2-11H,12-13H2,1H3,(H2,22,27)(H,23,28)(H,24,25,29) |
| InChIKey | SXCBDWFCXHULJH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|