C29H32N2O2 — CID 158131264
N,2-dimethyl-4-phenylmethoxyaniline;2-methyl-4-phenylmethoxyaniline (PubChem CID 158131264) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N,2-dimethyl-4-phenylmethoxyaniline;2-methyl-4-phenylmethoxyaniline.
| Compound Name | N,2-dimethyl-4-phenylmethoxyaniline;2-methyl-4-phenylmethoxyaniline |
|---|---|
| PubChem CID | 158131264 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N,2-dimethyl-4-phenylmethoxyaniline;2-methyl-4-phenylmethoxyaniline |
| SMILES | CNc1ccc(OCc2ccccc2)cc1C.Cc1cc(OCc2ccccc2)ccc1N |
| InChI | InChI=1S/C15H17NO.C14H15NO/c1-12-10-14(8-9-15(12)16-2)17-11-13-6-4-3-5-7-13;1-11-9-13(7-8-14(11)15)16-10-12-5-3-2-4-6-12/h3-10,16H,11H2,1-2H3;2-9H,10,15H2,1H3 |
| InChIKey | FSULRJWXRCSNLL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|