C30H32FN3O3 — CID 160962591
N,2-dimethyl-4-phenylmethoxyaniline;3-(4-fluorophenyl)-1-(4-hydroxy-2-methylphenyl)-1-methylurea (PubChem CID 160962591) has the molecular formula C30H32FN3O3 and a molecular weight of 501.60 g/mol. Its IUPAC name is N,2-dimethyl-4-phenylmethoxyaniline;3-(4-fluorophenyl)-1-(4-hydroxy-2-methylphenyl)-1-methylurea.
| Compound Name | N,2-dimethyl-4-phenylmethoxyaniline;3-(4-fluorophenyl)-1-(4-hydroxy-2-methylphenyl)-1-methylurea |
|---|---|
| PubChem CID | 160962591 |
| Molecular Formula | C30H32FN3O3 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N,2-dimethyl-4-phenylmethoxyaniline;3-(4-fluorophenyl)-1-(4-hydroxy-2-methylphenyl)-1-methylurea |
| SMILES | CNc1ccc(OCc2ccccc2)cc1C.Cc1cc(O)ccc1N(C)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN2O2.C15H17NO/c1-10-9-13(19)7-8-14(10)18(2)15(20)17-12-5-3-11(16)4-6-12;1-12-10-14(8-9-15(12)16-2)17-11-13-6-4-3-5-7-13/h3-9,19H,1-2H3,(H,17,20);3-10,16H,11H2,1-2H3 |
| InChIKey | SXEUDLAVUPIPAX-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|