About [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate
[1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 100768819) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
Molecular Properties
| Compound Name | [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| PubChem CID | 100768819 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)OC3(CC#N)CCC3)ccc21 |
| InChI | InChI=1S/C16H18N2O4S/c1-23(20,21)18-10-5-12-11-13(3-4-14(12)18)15(19)22-16(8-9-17)6-2-7-16/h3-4,11H,2,5-8,10H2,1H3 |
| InChIKey | LBRZDBGLANKMBB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate?
The IUPAC name of [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (CID 100768819) is [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
What is the SMILES notation for [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate?
The canonical SMILES for [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate is CS(=O)(=O)N1CCc2cc(C(=O)OC3(CC#N)CCC3)ccc21.
What is the InChIKey of [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate?
The InChIKey is LBRZDBGLANKMBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-23(20,21)18-10-5-12-11-13(3-4-14(12)18)15(19)22-16(8-9-17)6-2-7-16/h3-4,11H,2,5-8,10H2,1H3.
What are the key properties of [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate?
[1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate has a molecular weight of 334.40 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyanomethyl)cyclobutyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate is sourced from PubChem (CID 100768819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).