C20H24N4O — CID 100768878
4-amino-5-benzyl-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]pyrrole-2-carbonitrile (PubChem CID 100768878) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-amino-5-benzyl-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]pyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-benzyl-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100768878 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-amino-5-benzyl-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]pyrrole-2-carbonitrile |
| SMILES | CC1CCN(C(=O)Cn2c(C#N)cc(N)c2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O/c1-15-7-9-23(10-8-15)20(25)14-24-17(13-21)12-18(22)19(24)11-16-5-3-2-4-6-16/h2-6,12,15H,7-11,14,22H2,1H3 |
| InChIKey | LOFSPIMMMFEGMI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |