C22H16B2F12N4 — CID 10077042
1-phenyl-3-[3,3,4,4-tetrafluoro-2-(3-phenylimidazol-1-ium-1-yl)cyclobuten-1-yl]imidazol-3-ium ditetrafluoroborate (PubChem CID 10077042) has the molecular formula C22H16B2F12N4 and a molecular weight of 586.00 g/mol. Its IUPAC name is 1-phenyl-3-[3,3,4,4-tetrafluoro-2-(3-phenylimidazol-1-ium-1-yl)cyclobuten-1-yl]imidazol-3-ium ditetrafluoroborate.
| Compound Name | 1-phenyl-3-[3,3,4,4-tetrafluoro-2-(3-phenylimidazol-1-ium-1-yl)cyclobuten-1-yl]imidazol-3-ium ditetrafluoroborate |
|---|---|
| PubChem CID | 10077042 |
| Molecular Formula | C22H16B2F12N4 |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 1-phenyl-3-[3,3,4,4-tetrafluoro-2-(3-phenylimidazol-1-ium-1-yl)cyclobuten-1-yl]imidazol-3-ium ditetrafluoroborate |
| SMILES | FC1(F)C([n+]2ccn(-c3ccccc3)c2)=C([n+]2ccn(-c3ccccc3)c2)C1(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C22H16F4N4.2BF4/c23-21(24)19(29-13-11-27(15-29)17-7-3-1-4-8-17)20(22(21,25)26)30-14-12-28(16-30)18-9-5-2-6-10-18;2*2-1(3,4)5/h1-16H;;/q+2;2*-1 |
| InChIKey | HATRHLKEQYRBQV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|