C30H32N4O5S — CID 100771019
(2S)-4-[3-methyl-4-(2-methylpropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazine-7-carbonyl]-N-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 100771019) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is (2S)-4-[3-methyl-4-(2-methylpropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazine-7-carbonyl]-N-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-[3-methyl-4-(2-methylpropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazine-7-carbonyl]-N-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 100771019 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (2S)-4-[3-methyl-4-(2-methylpropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazine-7-carbonyl]-N-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC1=NS(=O)(=O)c2cc(C(=O)N3C[C@@H](C(=O)NCCc4ccccc4)Oc4ccccc43)ccc2N1CC(C)C |
| InChI | InChI=1S/C30H32N4O5S/c1-20(2)18-33-21(3)32-40(37,38)28-17-23(13-14-25(28)33)30(36)34-19-27(39-26-12-8-7-11-24(26)34)29(35)31-16-15-22-9-5-4-6-10-22/h4-14,17,20,27H,15-16,18-19H2,1-3H3,(H,31,35)/t27-/m0/s1 |
| InChIKey | CWVAZLCMLQJUND-MHZLTWQESA-N |
| XLogP | 4.04 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |