C22H27FN2O2 — CID 100771052
1-(2-fluorophenyl)-N-(2-methyl-6-propoxy-3-pyridinyl)cyclohexane-1-carboxamide (PubChem CID 100771052) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-methyl-6-propoxy-3-pyridinyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(2-methyl-6-propoxy-3-pyridinyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100771052 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-methyl-6-propoxy-3-pyridinyl)cyclohexane-1-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2(c3ccccc3F)CCCCC2)c(C)n1 |
| InChI | InChI=1S/C22H27FN2O2/c1-3-15-27-20-12-11-19(16(2)24-20)25-21(26)22(13-7-4-8-14-22)17-9-5-6-10-18(17)23/h5-6,9-12H,3-4,7-8,13-15H2,1-2H3,(H,25,26) |
| InChIKey | BGILRWMEFDPYGD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |