C22H27ClN2O3 — CID 100771590
1-(2-chlorophenyl)-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]cyclohexane-1-carboxamide (PubChem CID 100771590) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100771590 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]cyclohexane-1-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)C2(c3ccccc3Cl)CCCCC2)c(C)n1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-16-19(10-11-20(24-16)28-15-14-27-2)25-21(26)22(12-6-3-7-13-22)17-8-4-5-9-18(17)23/h4-5,8-11H,3,6-7,12-15H2,1-2H3,(H,25,26) |
| InChIKey | GZZKTNGEWGTYRX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|