C24H20N4O4 — CID 100773175
N-[(Z)-1-(furan-2-yl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 100773175) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 100773175 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(-c2noc(CNC(=O)/C(=C/c3ccco3)NC(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H20N4O4/c1-16-7-5-10-18(13-16)22-27-21(32-28-22)15-25-24(30)20(14-19-11-6-12-31-19)26-23(29)17-8-3-2-4-9-17/h2-14H,15H2,1H3,(H,25,30)(H,26,29)/b20-14- |
| InChIKey | FRXWWYRMLMFYNI-ZHZULCJRSA-N |
| XLogP | 3.73 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|