C19H17N3O2 — CID 71951744
N-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 71951744) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71951744 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(-c2noc(CNC(=O)C=Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H17N3O2/c1-14-6-5-9-16(12-14)19-21-18(24-22-19)13-20-17(23)11-10-15-7-3-2-4-8-15/h2-12H,13H2,1H3,(H,20,23) |
| InChIKey | JXRQPPUKKNEWDG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|