C19H17N3O3 — CID 50874819
(E)-3-(2-methoxyphenyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide (PubChem CID 50874819) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 50874819 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H17N3O3/c1-24-16-10-6-5-7-14(16)11-12-17(23)20-13-18-21-19(22-25-18)15-8-3-2-4-9-15/h2-12H,13H2,1H3,(H,20,23)/b12-11+ |
| InChIKey | VSYYQTBRSLSNDK-VAWYXSNFSA-N |
| XLogP | 3.07 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|