C17H12Cl2N4O2 — CID 78841224
(E)-3-(2,3-dichlorophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide (PubChem CID 78841224) has the molecular formula C17H12Cl2N4O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 78841224 |
| Molecular Formula | C17H12Cl2N4O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)NCc1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C17H12Cl2N4O2/c18-13-3-1-2-11(16(13)19)4-5-14(24)21-10-15-22-17(23-25-15)12-6-8-20-9-7-12/h1-9H,10H2,(H,21,24)/b5-4+ |
| InChIKey | JPWOCMXPLBYUAM-SNAWJCMRSA-N |
| XLogP | 3.77 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|