C18H15Cl2NO3 — CID 56579910
(E)-3-(2,3-dichlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)prop-2-enamide (PubChem CID 56579910) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 56579910 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)NCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C18H15Cl2NO3/c19-14-5-1-3-12(17(14)20)7-8-16(22)21-11-13-4-2-6-15-18(13)24-10-9-23-15/h1-8H,9-11H2,(H,21,22)/b8-7+ |
| InChIKey | AAISTMSOOSWBRX-BQYQJAHWSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|