C11H13Cl3N2O2 — CID 100773444
2,2,2-trichloro-N-(5-methyl-6-propoxy-3-pyridinyl)acetamide (PubChem CID 100773444) has the molecular formula C11H13Cl3N2O2 and a molecular weight of 311.60 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(5-methyl-6-propoxy-3-pyridinyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(5-methyl-6-propoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 100773444 |
| Molecular Formula | C11H13Cl3N2O2 |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2,2,2-trichloro-N-(5-methyl-6-propoxy-3-pyridinyl)acetamide |
| SMILES | CCCOc1ncc(NC(=O)C(Cl)(Cl)Cl)cc1C |
| InChI | InChI=1S/C11H13Cl3N2O2/c1-3-4-18-9-7(2)5-8(6-15-9)16-10(17)11(12,13)14/h5-6H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | HJEHDSIWTCVLFU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|