C23H40N2O4 — CID 100777968
N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide (PubChem CID 100777968) has the molecular formula C23H40N2O4 and a molecular weight of 408.58 g/mol. Its IUPAC name is N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide.
| Compound Name | N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
|---|---|
| PubChem CID | 100777968 |
| Molecular Formula | C23H40N2O4 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
| SMILES | CCCOC(CC(C)C)(CC(C)C)C(=O)Nc1cnc(OCCOCC)c(C)c1 |
| InChI | InChI=1S/C23H40N2O4/c1-8-10-29-23(14-17(3)4,15-18(5)6)22(26)25-20-13-19(7)21(24-16-20)28-12-11-27-9-2/h13,16-18H,8-12,14-15H2,1-7H3,(H,25,26) |
| InChIKey | XZEANRWZOMMOTH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|