C30H26O14 — CID 10077468
[(2S,3R,4R,5S,6S)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 10077468) has the molecular formula C30H26O14 and a molecular weight of 610.52 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 10077468 |
| Molecular Formula | C30H26O14 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C30H26O14/c1-12-23(37)28(43-21(36)7-4-13-2-5-15(31)6-3-13)26(40)30(41-12)44-29-25(39)22-17(33)10-16(32)11-20(22)42-27(29)14-8-18(34)24(38)19(35)9-14/h2-12,23,26,28,30-35,37-38,40H,1H3/b7-4+/t12-,23-,26+,28+,30-/m0/s1 |
| InChIKey | RYSFCGVNLBFFTE-MADGDFKXSA-N |
| XLogP | 2.16 |
| TPSA | 236.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|