C31H28O14 — CID 75251374
[2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 75251374) has the molecular formula C31H28O14 and a molecular weight of 624.55 g/mol. Its IUPAC name is [2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 75251374 |
| Molecular Formula | C31H28O14 |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | [2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC2C(O)C(C)OC(Oc3c(-c4ccc(O)c(O)c4)oc4cc(O)cc(O)c4c3=O)C2O)ccc1O |
| InChI | InChI=1S/C31H28O14/c1-13-25(38)29(44-23(37)8-4-14-3-6-18(34)21(9-14)41-2)27(40)31(42-13)45-30-26(39)24-20(36)11-16(32)12-22(24)43-28(30)15-5-7-17(33)19(35)10-15/h3-13,25,27,29,31-36,38,40H,1-2H3 |
| InChIKey | HSIKRZUIGSVYSG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 225.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|