C22H23IN4O6S2 — CID 10077731
(4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(1-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-7-yl)sulfanyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate iodide (PubChem CID 10077731) has the molecular formula C22H23IN4O6S2 and a molecular weight of 630.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(1-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-7-yl)sulfanyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate iodide.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(1-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-7-yl)sulfanyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate iodide |
|---|---|
| PubChem CID | 10077731 |
| Molecular Formula | C22H23IN4O6S2 |
| Molecular Weight | 630.49 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(1-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-7-yl)sulfanyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate iodide |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(SC3CCn4cc[n+](C)c43)S[C@H]12.[I-] |
| InChI | InChI=1S/C22H23N4O6S2.HI/c1-12(27)16-19(28)25-17(21(29)32-11-13-3-5-14(6-4-13)26(30)31)22(34-20(16)25)33-15-7-8-24-10-9-23(2)18(15)24;/h3-6,9-10,12,15-16,20,27H,7-8,11H2,1-2H3;1H/q+1;/p-1/t12-,15?,16+,20-;/m1./s1 |
| InChIKey | WZCOWQLGIJTMDK-HEEMGQFUSA-M |
| XLogP | -0.77 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.49 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|