C22H25NO2 — CID 100781422
1-(4-methylphenyl)-N-(4-prop-2-enoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 100781422) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-(4-prop-2-enoxyphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-(4-prop-2-enoxyphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100781422 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-(4-methylphenyl)-N-(4-prop-2-enoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(c3ccc(C)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C22H25NO2/c1-3-16-25-20-12-10-19(11-13-20)23-21(24)22(14-4-5-15-22)18-8-6-17(2)7-9-18/h3,6-13H,1,4-5,14-16H2,2H3,(H,23,24) |
| InChIKey | LNSRXBBKTYKPFT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|