C16H16F2N2O3S — CID 100783017
(3R)-N-(2-fluorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide (PubChem CID 100783017) has the molecular formula C16H16F2N2O3S and a molecular weight of 354.38 g/mol. Its IUPAC name is (3R)-N-(2-fluorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide.
| Compound Name | (3R)-N-(2-fluorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 100783017 |
| Molecular Formula | C16H16F2N2O3S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (3R)-N-(2-fluorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
| SMILES | CS(=O)(=O)N[C@H](CC(=O)Nc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F2N2O3S/c1-24(22,23)20-15(11-6-8-12(17)9-7-11)10-16(21)19-14-5-3-2-4-13(14)18/h2-9,15,20H,10H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | QULUCHZPJWXIKP-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |