C23H25ClF3NO3 — CID 100784348
4-(4-chlorophenyl)-N-[4-(2-methylpropoxy)-3-(trifluoromethyl)phenyl]oxane-4-carboxamide (PubChem CID 100784348) has the molecular formula C23H25ClF3NO3 and a molecular weight of 455.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-(2-methylpropoxy)-3-(trifluoromethyl)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-(2-methylpropoxy)-3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 100784348 |
| Molecular Formula | C23H25ClF3NO3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-(2-methylpropoxy)-3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
| SMILES | CC(C)COc1ccc(NC(=O)C2(c3ccc(Cl)cc3)CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H25ClF3NO3/c1-15(2)14-31-20-8-7-18(13-19(20)23(25,26)27)28-21(29)22(9-11-30-12-10-22)16-3-5-17(24)6-4-16/h3-8,13,15H,9-12,14H2,1-2H3,(H,28,29) |
| InChIKey | ZPPYABPRBDRNPY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |