C13H15N3O4 — CID 100784803
methyl 5-[(2-cyano-2-methylpropanoyl)amino]-2-methoxypyridine-3-carboxylate (PubChem CID 100784803) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 5-[(2-cyano-2-methylpropanoyl)amino]-2-methoxypyridine-3-carboxylate.
| Compound Name | methyl 5-[(2-cyano-2-methylpropanoyl)amino]-2-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 100784803 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 5-[(2-cyano-2-methylpropanoyl)amino]-2-methoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C(C)(C)C#N)cnc1OC |
| InChI | InChI=1S/C13H15N3O4/c1-13(2,7-14)12(18)16-8-5-9(11(17)20-4)10(19-3)15-6-8/h5-6H,1-4H3,(H,16,18) |
| InChIKey | ULJRSBCRHPWPEG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |