C11H10F3N3O5 — CID 164752222
2,2,2-trifluoroethyl 2-[(5-carbamoyl-6-methoxy-3-pyridinyl)amino]-2-oxoacetate (PubChem CID 164752222) has the molecular formula C11H10F3N3O5 and a molecular weight of 321.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(5-carbamoyl-6-methoxy-3-pyridinyl)amino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(5-carbamoyl-6-methoxy-3-pyridinyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 164752222 |
| Molecular Formula | C11H10F3N3O5 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(5-carbamoyl-6-methoxy-3-pyridinyl)amino]-2-oxoacetate |
| SMILES | COc1ncc(NC(=O)C(=O)OCC(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C11H10F3N3O5/c1-21-9-6(7(15)18)2-5(3-16-9)17-8(19)10(20)22-4-11(12,13)14/h2-3H,4H2,1H3,(H2,15,18)(H,17,19) |
| InChIKey | LMOXSBVYDALFOV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|