C14H10ClF2N3O3 — CID 167829005
5-[(2-chloro-4,5-difluorobenzoyl)amino]-2-methoxypyridine-3-carboxamide (PubChem CID 167829005) has the molecular formula C14H10ClF2N3O3 and a molecular weight of 341.70 g/mol. Its IUPAC name is 5-[(2-chloro-4,5-difluorobenzoyl)amino]-2-methoxypyridine-3-carboxamide.
| Compound Name | 5-[(2-chloro-4,5-difluorobenzoyl)amino]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 167829005 |
| Molecular Formula | C14H10ClF2N3O3 |
| Molecular Weight | 341.70 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5-[(2-chloro-4,5-difluorobenzoyl)amino]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cc(F)c(F)cc2Cl)cc1C(N)=O |
| InChI | InChI=1S/C14H10ClF2N3O3/c1-23-14-8(12(18)21)2-6(5-19-14)20-13(22)7-3-10(16)11(17)4-9(7)15/h2-5H,1H3,(H2,18,21)(H,20,22) |
| InChIKey | FANFZNWUIPQXFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|