C26H32FIN2O3 — CID 10078553
N-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-N-[(4-fluorophenyl)methyl]-2-(4-iodophenyl)acetamide (PubChem CID 10078553) has the molecular formula C26H32FIN2O3 and a molecular weight of 566.46 g/mol. Its IUPAC name is N-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-N-[(4-fluorophenyl)methyl]-2-(4-iodophenyl)acetamide.
| Compound Name | N-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-N-[(4-fluorophenyl)methyl]-2-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 10078553 |
| Molecular Formula | C26H32FIN2O3 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | N-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-N-[(4-fluorophenyl)methyl]-2-(4-iodophenyl)acetamide |
| SMILES | O=C(Cc1ccc(I)cc1)N(Cc1ccc(F)cc1)C1CCN(CCC2OCCCO2)CC1 |
| InChI | InChI=1S/C26H32FIN2O3/c27-22-6-2-21(3-7-22)19-30(25(31)18-20-4-8-23(28)9-5-20)24-10-13-29(14-11-24)15-12-26-32-16-1-17-33-26/h2-9,24,26H,1,10-19H2 |
| InChIKey | NWXHJIXUYDTDBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|