C22H27IN2O — CID 68956341
2-(4-iodophenyl)-N-[(4-methylphenyl)methyl]-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 68956341) has the molecular formula C22H27IN2O and a molecular weight of 462.38 g/mol. Its IUPAC name is 2-(4-iodophenyl)-N-[(4-methylphenyl)methyl]-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-(4-iodophenyl)-N-[(4-methylphenyl)methyl]-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 68956341 |
| Molecular Formula | C22H27IN2O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-(4-iodophenyl)-N-[(4-methylphenyl)methyl]-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1ccc(CN(C(=O)Cc2ccc(I)cc2)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H27IN2O/c1-17-3-5-19(6-4-17)16-25(21-11-13-24(2)14-12-21)22(26)15-18-7-9-20(23)10-8-18/h3-10,21H,11-16H2,1-2H3 |
| InChIKey | RQBKKQLZFILWSV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|