C10H13N5 — CID 100786207
3-N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 100786207) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 100786207 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1ccc(C)c(Nc2n[nH]c(N)n2)c1 |
| InChI | InChI=1S/C10H13N5/c1-6-3-4-7(2)8(5-6)12-10-13-9(11)14-15-10/h3-5H,1-2H3,(H4,11,12,13,14,15) |
| InChIKey | YSQWKMGBPKGJQD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |