C12H22N2 — CID 100792255
N-[(1,5-diethylpyrrol-2-yl)methyl]propan-2-amine (PubChem CID 100792255) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-[(1,5-diethylpyrrol-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(1,5-diethylpyrrol-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 100792255 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-[(1,5-diethylpyrrol-2-yl)methyl]propan-2-amine |
| SMILES | CCc1ccc(CNC(C)C)n1CC |
| InChI | InChI=1S/C12H22N2/c1-5-11-7-8-12(14(11)6-2)9-13-10(3)4/h7-8,10,13H,5-6,9H2,1-4H3 |
| InChIKey | VQFUDXNFAURDRI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |