C14H22N4 — CID 66402190
N-[[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]methyl]propan-2-amine (PubChem CID 66402190) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-[[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66402190 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-[[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]methyl]propan-2-amine |
| SMILES | CCn1ccnc1Cn1cccc1CNC(C)C |
| InChI | InChI=1S/C14H22N4/c1-4-17-9-7-15-14(17)11-18-8-5-6-13(18)10-16-12(2)3/h5-9,12,16H,4,10-11H2,1-3H3 |
| InChIKey | JOEJMFNVBFFNKL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |