C13H20N4 — CID 79102946
1-[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]-N-methylethanamine (PubChem CID 79102946) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]-N-methylethanamine.
| Compound Name | 1-[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 79102946 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-[1-[(1-ethylimidazol-2-yl)methyl]pyrrol-2-yl]-N-methylethanamine |
| SMILES | CCn1ccnc1Cn1cccc1C(C)NC |
| InChI | InChI=1S/C13H20N4/c1-4-16-9-7-15-13(16)10-17-8-5-6-12(17)11(2)14-3/h5-9,11,14H,4,10H2,1-3H3 |
| InChIKey | XEPFPUAICZIPMK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |