C34H45Cl2N7O4S — CID 10079793
4-[1-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]cyclopentanecarbonyl]-N'-[3-(dimethylamino)propyl]piperazine-1-carboximidamide (PubChem CID 10079793) has the molecular formula C34H45Cl2N7O4S and a molecular weight of 718.75 g/mol. Its IUPAC name is 4-[1-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]cyclopentanecarbonyl]-N'-[3-(dimethylamino)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-[1-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]cyclopentanecarbonyl]-N'-[3-(dimethylamino)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 10079793 |
| Molecular Formula | C34H45Cl2N7O4S |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 4-[1-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]cyclopentanecarbonyl]-N'-[3-(dimethylamino)propyl]piperazine-1-carboximidamide |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC4(C(=O)N5CCN(/C(N)=N/CCCN(C)C)CC5)CCCC4)c3Cl)c2n1 |
| InChI | InChI=1S/C34H45Cl2N7O4S/c1-23-21-24(2)39-31-25(23)9-7-10-28(31)47-22-26-27(35)11-12-29(30(26)36)48(45,46)40-34(13-5-6-14-34)32(44)42-17-19-43(20-18-42)33(37)38-15-8-16-41(3)4/h7,9-12,21,40H,5-6,8,13-20,22H2,1-4H3,(H2,37,38) |
| InChIKey | GRBKYJHPFBQCDR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|