C17H32NO4+ — CID 100798941
(2R)-1-[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol (PubChem CID 100798941) has the molecular formula C17H32NO4+ and a molecular weight of 314.45 g/mol. Its IUPAC name is (2R)-1-[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol.
| Compound Name | (2R)-1-[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 100798941 |
| Molecular Formula | C17H32NO4+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2R)-1-[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol |
| SMILES | C[N+]1(C[C@@H](O)COCCO[C@@H]2C[C@@H]3CC[C@@H]2C3)CCOCC1 |
| InChI | InChI=1S/C17H32NO4/c1-18(4-6-20-7-5-18)12-16(19)13-21-8-9-22-17-11-14-2-3-15(17)10-14/h14-17,19H,2-13H2,1H3/q+1/t14-,15-,16-,17-/m1/s1 |
| InChIKey | AAKUNFYHSUBHKE-QBPKDAKJSA-N |
| XLogP | 1.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|