C22H18BrN3O4S — CID 100800638
2-[4-[(4-bromophenyl)sulfamoyl]phenoxy]-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 100800638) has the molecular formula C22H18BrN3O4S and a molecular weight of 500.37 g/mol. Its IUPAC name is 2-[4-[(4-bromophenyl)sulfamoyl]phenoxy]-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(4-bromophenyl)sulfamoyl]phenoxy]-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100800638 |
| Molecular Formula | C22H18BrN3O4S |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 2-[4-[(4-bromophenyl)sulfamoyl]phenoxy]-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | N#CCc1ccc(NC(=O)COc2ccc(S(=O)(=O)Nc3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18BrN3O4S/c23-17-3-7-19(8-4-17)26-31(28,29)21-11-9-20(10-12-21)30-15-22(27)25-18-5-1-16(2-6-18)13-14-24/h1-12,26H,13,15H2,(H,25,27) |
| InChIKey | SPMZGNCNZVAVNA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |