C23H20FN3O4S — CID 100796591
N-[4-(cyanomethyl)phenyl]-2-[4-[(4-fluorophenyl)sulfamoyl]-2-methylphenoxy]acetamide (PubChem CID 100796591) has the molecular formula C23H20FN3O4S and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-[4-[(4-fluorophenyl)sulfamoyl]-2-methylphenoxy]acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-[4-[(4-fluorophenyl)sulfamoyl]-2-methylphenoxy]acetamide |
|---|---|
| PubChem CID | 100796591 |
| Molecular Formula | C23H20FN3O4S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-[4-[(4-fluorophenyl)sulfamoyl]-2-methylphenoxy]acetamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1OCC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C23H20FN3O4S/c1-16-14-21(32(29,30)27-20-8-4-18(24)5-9-20)10-11-22(16)31-15-23(28)26-19-6-2-17(3-7-19)12-13-25/h2-11,14,27H,12,15H2,1H3,(H,26,28) |
| InChIKey | FRYDSPZDLLIKCW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |