C21H15F2N3O4S — CID 24636548
2-(2-cyanophenoxy)-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 24636548) has the molecular formula C21H15F2N3O4S and a molecular weight of 443.43 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 24636548 |
| Molecular Formula | C21H15F2N3O4S |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H15F2N3O4S/c22-18-10-9-17(11-19(18)23)31(28,29)26-16-7-5-15(6-8-16)25-21(27)13-30-20-4-2-1-3-14(20)12-24/h1-11,26H,13H2,(H,25,27) |
| InChIKey | QYRPQEPBXUZKHO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |