C24H23N3O4S — CID 100796723
2-[4-(benzylsulfamoyl)-2-methylphenoxy]-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 100796723) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[4-(benzylsulfamoyl)-2-methylphenoxy]-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[4-(benzylsulfamoyl)-2-methylphenoxy]-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100796723 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[4-(benzylsulfamoyl)-2-methylphenoxy]-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccccc2)ccc1OCC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-18-15-22(32(29,30)26-16-20-5-3-2-4-6-20)11-12-23(18)31-17-24(28)27-21-9-7-19(8-10-21)13-14-25/h2-12,15,26H,13,16-17H2,1H3,(H,27,28) |
| InChIKey | NABRCYJGHRKRFG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |