C21H18ClFN2O4S — CID 3969964
2-[4-(benzylsulfamoyl)-2-chlorophenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 3969964) has the molecular formula C21H18ClFN2O4S and a molecular weight of 448.90 g/mol. Its IUPAC name is 2-[4-(benzylsulfamoyl)-2-chlorophenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(benzylsulfamoyl)-2-chlorophenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3969964 |
| Molecular Formula | C21H18ClFN2O4S |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-[4-(benzylsulfamoyl)-2-chlorophenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NCc2ccccc2)cc1Cl)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18ClFN2O4S/c22-19-12-18(30(27,28)24-13-15-4-2-1-3-5-15)10-11-20(19)29-14-21(26)25-17-8-6-16(23)7-9-17/h1-12,24H,13-14H2,(H,25,26) |
| InChIKey | CYXNVCITTBROLI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |