About N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide
N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide (PubChem CID 100801872) has the molecular formula C21H15F6N3O2
and a molecular weight of 455.36 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide |
| PubChem CID | 100801872 |
| Molecular Formula | C21H15F6N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide |
| SMILES | COc1ccc(-c2ncc(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(C)n2)cc1 |
| InChI | InChI=1S/C21H15F6N3O2/c1-11-17(10-28-18(29-11)12-3-5-16(32-2)6-4-12)19(31)30-15-8-13(20(22,23)24)7-14(9-15)21(25,26)27/h3-10H,1-2H3,(H,30,31) |
| InChIKey | MHEJOPVLMLNYFH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide (CID 100801872) is N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide is COc1ccc(-c2ncc(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(C)n2)cc1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide?
The InChIKey is MHEJOPVLMLNYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F6N3O2/c1-11-17(10-28-18(29-11)12-3-5-16(32-2)6-4-12)19(31)30-15-8-13(20(22,23)24)7-14(9-15)21(25,26)27/h3-10H,1-2H3,(H,30,31).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide?
N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide has a molecular weight of 455.36 g/mol, XLogP of 5.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)-4-methylpyrimidine-5-carboxamide is sourced from PubChem (CID 100801872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).