C24H25F3N4O — CID 53080279
N-[4-(diethylamino)-2-methylphenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide (PubChem CID 53080279) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53080279 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cnc(-c3ccc(C(F)(F)F)cc3)nc2C)c(C)c1 |
| InChI | InChI=1S/C24H25F3N4O/c1-5-31(6-2)19-11-12-21(15(3)13-19)30-23(32)20-14-28-22(29-16(20)4)17-7-9-18(10-8-17)24(25,26)27/h7-14H,5-6H2,1-4H3,(H,30,32) |
| InChIKey | DWPCZSXLGRJFPC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|