C18H29N3O — CID 100803137
N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]hexanamide (PubChem CID 100803137) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]hexanamide.
| Compound Name | N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 100803137 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cc(N)ccc1N1CCCC[C@H]1C |
| InChI | InChI=1S/C18H29N3O/c1-3-4-5-9-18(22)20-16-13-15(19)10-11-17(16)21-12-7-6-8-14(21)2/h10-11,13-14H,3-9,12,19H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | OYVWAYHVRRCPEO-CQSZACIVSA-N |
| XLogP | 4.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|