C15H15NO3 — CID 100803950
(R)-(3,4-dimethylphenyl)-(3-nitrophenyl)methanol (PubChem CID 100803950) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (R)-(3,4-dimethylphenyl)-(3-nitrophenyl)methanol.
| Compound Name | (R)-(3,4-dimethylphenyl)-(3-nitrophenyl)methanol |
|---|---|
| PubChem CID | 100803950 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (R)-(3,4-dimethylphenyl)-(3-nitrophenyl)methanol |
| SMILES | Cc1ccc([C@@H](O)c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C15H15NO3/c1-10-6-7-13(8-11(10)2)15(17)12-4-3-5-14(9-12)16(18)19/h3-9,15,17H,1-2H3/t15-/m0/s1 |
| InChIKey | DOEFDDZJWYMHQG-HNNXBMFYSA-N |
| XLogP | 3.29 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|