C23H26N2O2 — CID 175235813
(1S)-N-[(3,4-dimethylphenyl)-(3-nitrophenyl)methyl]-1-ethylcyclohexa-2,4-dien-1-amine (PubChem CID 175235813) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S)-N-[(3,4-dimethylphenyl)-(3-nitrophenyl)methyl]-1-ethylcyclohexa-2,4-dien-1-amine.
| Compound Name | (1S)-N-[(3,4-dimethylphenyl)-(3-nitrophenyl)methyl]-1-ethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 175235813 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1S)-N-[(3,4-dimethylphenyl)-(3-nitrophenyl)methyl]-1-ethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC[C@@]1(NC(c2cccc([N+](=O)[O-])c2)c2ccc(C)c(C)c2)C=CC=CC1 |
| InChI | InChI=1S/C23H26N2O2/c1-4-23(13-6-5-7-14-23)24-22(20-12-11-17(2)18(3)15-20)19-9-8-10-21(16-19)25(26)27/h5-13,15-16,22,24H,4,14H2,1-3H3/t22?,23-/m1/s1 |
| InChIKey | WCSKRAMKFRXWCP-OZAIVSQSSA-N |
| XLogP | 5.56 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|